methenamine
chemical compound
External resources
| MedlinePlus drug identifier | |
| CAS Registry Number | |
| ZVG number | |
| HCIS ID | |
| MeSH descriptor ID | D008709 subject named as: Methenamine |
| Treccani ID | |
| NSC number | |
| ChEMBL ID | |
| Gran Enciclopèdia Catalana ID | |
| Human Metabolome Database ID | |
| E number | |
| MeSH tree code | |
| Great Russian Encyclopedia Online ID (old version) | 2348383 subject named as: ГЕКСАМЕТИЛЕНТЕТРАМИН |
| ECHA Substance Infocard ID | |
| DrugCentral ID | |
| CAMEO Chemicals ID | |
| Probes And Drugs ID | |
| NDF-RT ID | |
| Freebase ಐಡಿ | |
| Reaxys registry number | 2018[೯] |
| PubChem CID | |
| UniChem compound ID | |
| Quora topic ID | |
| SPLASH | |
| PesticideInfo chemical ID | |
| OpenAlex ID | |
| InChIKey | |
| DrugBank ID | |
| UNII | |
| Gran Enciclopèdia Catalana ID (former scheme) | 0114125 subject named as: hexametilentetramina 0149518 subject named as: urotropina |
| WikiProjectMed ID | |
| CosIng number | |
| RxNorm ID | |
| SureChEMBL ID | |
| MassBank accession ID | |
| DSSTox substance ID | |
| Lex ID | |
| GND ಐಡಿ | |
| ICSC ID | |
| Microsoft Academic ID | |
| DSSTOX compound identifier | |
| InChI | |
| UMLS CUI | |
| KEGG ID | |
| KBpedia ID | |
| ChemSpider ID | |
| EC number | |
| ChEBI ID | |
| Guide to Pharmacology Ligand ID | |
| Gmelin number | 26964 |
| ATC code | |
| NMRShiftDB structure ID | |
| HSDB ID |
ಉದಾಹರಣೆಗೆ
type of chemical entity
ಉಪವರ್ಗ
chemical structure
image of molecular model or crystal lattice model
mass
೧೪೦.೧೦೬ dalton[೧೦]
discoverer or inventor
Alexander Butlerov
ಕಂಡುಹಿಡಿದ ಸಮಯ
1859
chemical formula
C₆H₁₂N₄[೧೦]
canonical SMILES
C1N2CN3CN1CN(C2)C3[೧೦]
World Health Organisation international non-proprietary name
methenamine[೯]
described by source
Ottův slovník naučný
statement is subject of: Q97030364, Q97035504
Encyclopædia Britannica 11th edition
statement is subject of: 1911 Encyclopædia Britannica/Urotropin
Armenian Soviet Encyclopedia, vol. 6
page(s): 386
ಕಾಮನ್ಸ್ ವರ್ಗ
Hexamine
Reference
- ↑ ೧.೦ ೧.೧ ೧.೨ ೧.೩ ೧.೪ ೧.೫ Global Substance Registration System, ೧೭ ನವೆಂಬರ್ 2016, ಆಂಗ್ಲ, methenamine, J50OIX95QV
- ↑ CAS Common Chemistry, ೧೦ ಏಪ್ರಿಲ್ 2021, VKYKSIONXSXAKP-UHFFFAOYSA-N, https://commonchemistry.cas.org/detail?cas_rn=100-97-0
- ↑ ೩.೦ ೩.೧ ChEMBL, ೧೭ ನವೆಂಬರ್ 2016, ಆಂಗ್ಲ, METHENAMINE, CHEMBL1201270
- ↑ ೪.೦ ೪.೧ inferred from InChIKey
- ↑ ೫.೦ ೫.೧ ೫.೨ ೫.೩ ೫.೪ ೫.೫ ೫.೬ VKYKSIONXSXAKP-UHFFFAOYSA-N, InChIKey
- ↑ ECHA Substance Infocard database, ೨೭ ಡಿಸೆಂಬರ್ 2018, 100.002.642, Methenamine, CAS no.: 100-97-0
- ↑ ೭.೦ ೭.೧ UniChem
- ↑ Freebase Data Dumps, ೨೮ ಅಕ್ಟೋಬರ್ 2013
- ↑ ೯.೦ ೯.೧ ೯.೨ ChEBI, ೪ ಅಕ್ಟೋಬರ್ 2016, ಆಂಗ್ಲ, hexamethylenetetramine, 6824
- ↑ ೧೦.೦ ೧೦.೧ ೧೦.೨ ೧೦.೩ ೧೦.೪ ೧೦.೫ PubChem, ೧೭ ನವೆಂಬರ್ 2016, ಆಂಗ್ಲ, 4101, Hexamethylenetetramine
- ↑ Quora
- ↑ OpenAlex, ೨೬ ಜನವರಿ 2022, https://docs.openalex.org/download-snapshot/snapshot-data-format
- ↑ ChEBI release 2020-09-01
- ↑ CosIng database, ೨೮ ಡಿಸೆಂಬರ್ 2019, 35256, METHENAMINE, CAS no.: 100-97-0
- ↑ Mapping file of InChIStrings, InChIKeys and DTXSIDs for the EPA CompTox Dashboard
- ↑ KBpedia, ೯ ಜುಲೈ 2020
- ↑ ChemSpider, ೧೭ ನವೆಂಬರ್ 2016, ಆಂಗ್ಲ, 3959, Hexamine
- ↑ International Chemical Identifier, InChI=1S/C6H12N4/c1-7-2-9-4-8(1)5-10(3-7)6-9/h1-6H2
- ↑ IUPHAR/BPS Guide to PHARMACOLOGY, ೫ ಫೆಬ್ರವರಿ 2021
- ↑ DrugBank, ಆಂಗ್ಲ, ೧೭ ನವೆಂಬರ್ 2015, 06799, Hexamethylenetetramine
- ↑ Hazardous Substances Data Bank, ೧೦ ಮೇ 2021, ೨೮ ಅಕ್ಟೋಬರ್ 2019, METHENAMINE, 563
- ↑ DrugBank, ಆಂಗ್ಲ, ೧೭ ನವೆಂಬರ್ 2015, Hexamethylenetetramine, 06799
- ↑ RxNorm, 151856, ೧೪ ಫೆಬ್ರವರಿ 2018
- ↑ RxNorm, 220684, ೧೪ ಫೆಬ್ರವರಿ 2018
- ↑ ೨೫.೦ ೨೫.೧ ೨೫.೨ N0000146894, ೧೩ ಡಿಸೆಂಬರ್ 2016, NDF-RT, ಆಂಗ್ಲ
- ↑ Medical Subject Headings, ೧೫ ಮಾರ್ಚ್ 2018, D008709
- ↑ ChEBI, 6824